For research use only. Not for therapeutic Use.
Dronedarone（Cat No.:I001599）is an antiarrhythmic medication used to treat atrial fibrillation (AF) and atrial flutter (AFL). It works by blocking multiple ion channels, including potassium, sodium, and calcium channels, which helps to regulate the heart’s electrical activity and maintain a normal rhythm. Dronedarone is structurally related to amiodarone but is designed to have fewer side effects, particularly less thyroid and lung toxicity. It is commonly prescribed to reduce the risk of hospitalization due to recurrent AF or AFL in patients with stable cardiovascular conditions, offering a safer alternative for long-term management.
| Catalog Number | I001599 |
| CAS Number | 141626-36-0 |
| Synonyms | N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
| Molecular Formula | C31H44N2O5S |
| Purity | ≥95% |
| Target | CYP3A/CYP450 |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-[2-butyl-3-[4-[3-(dibutylamino)propoxy]benzoyl]-1-benzofuran-5-yl]methanesulfonamide |
| InChI | InChI=1S/C31H44N2O5S/c1-5-8-12-29-30(27-23-25(32-39(4,35)36)15-18-28(27)38-29)31(34)24-13-16-26(17-14-24)37-22-11-21-33(19-9-6-2)20-10-7-3/h13-18,23,32H,5-12,19-22H2,1-4H3 |
| InChIKey | ZQTNQVWKHCQYLQ-UHFFFAOYSA-N |
| SMILES | CCCCC1=C(C2=C(O1)C=CC(=C2)NS(=O)(=O)C)C(=O)C3=CC=C(C=C3)OCCCN(CCCC)CCCC |
| Reference | <p style=/line-height:25px/> |
