For research use only. Not for therapeutic Use.
Droperidol(CAT: A000860) is a butyrophenone derivative with potent antiemetic and sedative properties, commonly used in anesthesia and emergency medicine to prevent nausea, vomiting, and agitation. It acts as a dopamine (D2) receptor antagonist, particularly in the chemoreceptor trigger zone, making it highly effective against postoperative nausea and vomiting. Additionally, its sedative properties stem from its influence on central dopamine pathways, which makes it useful in managing acute psychosis and delirium. However, due to potential cardiovascular side effects, including QT prolongation, its use requires careful monitoring. Droperidol remains a valuable option in clinical settings, particularly when rapid onset of action and short duration are essential.
| Catalog Number | A000860 |
| CAS Number | 548-73-2 |
| Synonyms | 548-73-2; Droleptan; Inapsine; Dehydrobenzperidol; Properidol |
| Molecular Formula | C22H22FN3O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Storage | -20°C |
| InChI | InChI=1S/C22H22FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-11H,3,6,12-15H2,(H,24,28) |
| InChIKey | RMEDXOLNCUSCGS-UHFFFAOYSA-N |
| SMILES | C1CN(CC=C1N2C3=CC=CC=C3NC2=O)CCCC(=O)C4=CC=C(C=C4)F |
