For research use only. Not for therapeutic Use.
DS12881479（Cat No.:I042887）is a chemical compound under investigation for its potential therapeutic applications in the treatment of various diseases, particularly those involving inflammation and immune system modulation. It is a small molecule designed to target specific cellular pathways involved in inflammatory responses, offering a novel approach for managing conditions such as autoimmune disorders and chronic inflammatory diseases. Researchers are exploring its efficacy in preclinical studies, with an emphasis on reducing symptoms by modulating immune cell activation and cytokine production. DS12881479 shows promise as a future treatment option pending further clinical evaluation.
| CAS Number | 2373065-59-7 |
| Synonyms | 1-methyl-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| Molecular Formula | C16H19N3OS |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-4-carboxamide |
| InChI | InChI=1S/C16H19N3OS/c1-19-9-7-13(8-10-19)15(20)18-16-17-11-14(21-16)12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H,17,18,20) |
| InChIKey | BTZKRRFKIKIADV-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C(=O)NC2=NC=C(S2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
