For research use only. Not for therapeutic Use.
DS17 (Cat No.: I040104) is a small-molecule compound with potential therapeutic applications, particularly in cancer treatment. It is known for its ability to inhibit specific signaling pathways involved in tumor cell growth and survival, potentially enhancing the efficacy of other treatments. DS17 targets key molecular targets related to cell proliferation, apoptosis, and metastasis, making it a promising candidate in oncology research. Preclinical studies suggest it could be effective in treating various cancers, but further research is necessary to assess its safety, efficacy, and clinical applications.
Synonyms | (2R)-2-[[6-[(5,6-dichloro-1H-benzimidazol-2-yl)methylamino]-9-propan-2-ylpurin-2-yl]amino]butan-1-ol |
Molecular Formula | C20H24Cl2N8O |
Purity | ≥95% |
InChI | InChI=1S/C20H24Cl2N8O/c1-4-11(8-31)25-20-28-18(17-19(29-20)30(9-24-17)10(2)3)23-7-16-26-14-5-12(21)13(22)6-15(14)27-16/h5-6,9-11,31H,4,7-8H2,1-3H3,(H,26,27)(H2,23,25,28,29)/t11-/m1/s1 |
InChIKey | NIAQZRDKVVUEMV-LLVKDONJSA-N |
SMILES | CCC(CO)NC1=NC(=C2C(=N1)N(C=N2)C(C)C)NCC3=NC4=CC(=C(C=C4N3)Cl)Cl |
Reference | [1]. Zuzanna Kozicka, et al. Design principles for cyclin K molecular glue degraders. Nat Chem Zuzanna Kozicka, et al. Design principles for cyclin K molecular glue degraders. Nat Chem Biol. 2024 Jan;20(1):93-102. Biol. 2024 Jan;20(1):93-102. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |