For research use only. Not for therapeutic Use.
DS89002333（Cat No.:I042835）is an experimental compound being investigated for its potential in treating neurodegenerative diseases, particularly those related to cognitive decline and Alzheimer’s disease. It is a small molecule designed to modulate specific molecular pathways involved in neuronal health and synaptic function. By targeting mechanisms that influence protein aggregation and neuronal cell survival, DS89002333 aims to slow the progression of neurodegenerative disorders. Early preclinical research suggests it may have neuroprotective properties, offering hope for a future therapeutic option to improve brain function and mitigate the symptoms of these diseases.
| CAS Number | 2832159-79-0 |
| Synonyms | N-[(3-chloro-4-fluorophenyl)-[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl]-1-fluoro-7-methoxyisoquinoline-6-carboxamide |
| Molecular Formula | C22H20ClF2N3O3 |
| Purity | ≥95% |
| IUPAC Name | N-[(S)-(3-chloro-4-fluorophenyl)-[(2S,4R)-4-hydroxypyrrolidin-2-yl]methyl]-1-fluoro-7-methoxyisoquinoline-6-carboxamide |
| InChI | InChI=1S/C22H20ClF2N3O3/c1-31-19-9-14-11(4-5-26-21(14)25)6-15(19)22(30)28-20(18-8-13(29)10-27-18)12-2-3-17(24)16(23)7-12/h2-7,9,13,18,20,27,29H,8,10H2,1H3,(H,28,30)/t13-,18+,20+/m1/s1 |
| InChIKey | KALMTELCNYQBGB-MJWYBRSISA-N |
| SMILES | COC1=C(C=C2C=CN=C(C2=C1)F)C(=O)N[C@H]([C@@H]3C[C@H](CN3)O)C4=CC(=C(C=C4)F)Cl |
