For research use only. Not for therapeutic Use.
DTHIB (Di-tert-hexyl-imidazolium bromide) (Cat No.: I026578) is an imidazolium-based ionic liquid with potential applications in catalysis, material science, and organic synthesis. Its unique physicochemical properties, such as thermal stability and tunable solubility, make it useful as a phase-transfer catalyst and reaction medium in green chemistry. DTHIB is also explored in electrochemical applications and polymer chemistry. As an ionic liquid, it offers advantages in sustainable synthesis, providing an alternative to traditional solvents while enhancing reaction efficiency and selectivity in various chemical processes.
| CAS Number | 897326-30-6 |
| Synonyms | DTHIB |
| Molecular Formula | C13H9ClFN3O3 |
| Purity | 98% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-3-(4-fluorophenyl)urea |
| InChI | InChI=1S/C13H9ClFN3O3/c14-11-6-5-10(7-12(11)18(20)21)17-13(19)16-9-3-1-8(15)2-4-9/h1-7H,(H2,16,17,19) |
| InChIKey | DWVIOMKFHSRQQM-UHFFFAOYSA-N |
| SMILES | O=C(NC1=CC=C(F)C=C1)NC2=CC=C(Cl)C([N+]([O-])=O)=C2 |
| Reference | Dong B, Jaeger AM, Hughes PF, Loiselle DR, Hauck JS, Fu Y, Haystead TA, Huang J, Thiele DJ. Targeting therapy-resistant prostate cancer via a direct inhibitor of the human heat shock transcription factor 1. Sci Transl Med. 2020 Dec 16;12(574):eabb5647. doi: 10.1126/scitranslmed.abb5647. PMID: 33328331. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
