For research use only. Not for therapeutic Use.
Dulcitol (Cat.No:R057005) is a natural sugar alcohol, also known as galactitol. It occurs in various plants and algae. While it’s not typically used as a sweetener due to its lower sweetness compared to sucrose, it has applications in pharmaceuticals and as a cryoprotectant in cell preservation.
| Catalog Number | R057005 |
| CAS Number | 608-66-2 |
| Synonyms | Galactitol; Dulcite; Dulcose; Euonymit; Melampyrin; Melampyrit; NSC 1944; |
| Molecular Formula | C6H14O6 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (2R,3S,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5+,6- |
| InChIKey | FBPFZTCFMRRESA-GUCUJZIJSA-N |
| SMILES | C(C(C(C(C(CO)O)O)O)O)O |
