For research use only. Not for therapeutic Use.
DUN09716（Cat No.:I026594）is an investigational compound with limited publicly available information regarding its specific function or therapeutic target. It may be under research for its potential role in modulating specific biological pathways or receptor activities. Compounds like DUN09716 are often explored in the context of drug discovery and development, particularly in areas such as oncology, inflammation, or neurological disorders. Ongoing studies will provide further insights into its mechanism of action, potential therapeutic applications, and its efficacy in preclinical or clinical settings.
| Catalog Number | I026594 |
| CAS Number | 300809-71-6 |
| Synonyms | DUN09716; DUN-09716; DUN 09716; |
| Molecular Formula | C13H9ClN2S2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroaniline |
| InChI | InChI=1S/C13H9ClN2S2/c14-9-7-8(15)5-6-11(9)17-13-16-10-3-1-2-4-12(10)18-13/h1-7H,15H2 |
| InChIKey | DTSNLMOLTVGCGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC3=C(C=C(C=C3)N)Cl |
