For research use only. Not for therapeutic Use.
Duocarmycin Analog（Cat No.:I017812）, as an analog of Duocarmycin, is a compound that functions as a DNA alkylator and ADC cytotoxin. It shares structural similarities with Duocarmycin and exhibits similar mechanisms of action, including the ability to alkylate DNA and induce DNA damage. These properties make it a potential candidate for targeted cancer therapies, particularly in the development of antibody-drug conjugates (ADCs), where the analog can be conjugated to antibodies to selectively deliver cytotoxic effects to cancer cells expressing specific targets.
| Catalog Number | I017812 |
| CAS Number | 372954-15-9 |
| Molecular Formula | C₃₄H₃₁ClN₄O₅ |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | tert-butyl N-[4-[[2-[(1S)-1-(chloromethyl)-5-hydroxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]carbamoyl]phenyl]carbamate |
| InChI | InChI=1S/C34H31ClN4O5/c1-34(2,3)44-33(43)37-22-10-8-19(9-11-22)31(41)36-23-12-13-26-20(14-23)15-27(38-26)32(42)39-18-21(17-35)30-25-7-5-4-6-24(25)29(40)16-28(30)39/h4-16,21,38,40H,17-18H2,1-3H3,(H,36,41)(H,37,43)/t21-/m1/s1 |
| InChIKey | JPKOARKDKWYROQ-OAQYLSRUSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)NC(=C3)C(=O)N4CC(C5=C4C=C(C6=CC=CC=C65)O)CCl |
| Reference | [1]. Boger, Dale L. CBI ANALOGUES OF CC-1065 AND THE DUOCARMYCINS. WO2003022806A2 |
