For research use only. Not for therapeutic Use.
Duocarmycin SA（Cat No.:M105676） is a potent cytotoxic agent belonging to the duocarmycin family of antitumor antibiotics. It functions primarily through binding to the minor groove of DNA, causing alkylation and subsequent strand breaks. This action disrupts DNA replication and transcription processes, leading to cell death, making it highly effective against cancer cells. Due to its potent activity, Duocarmycin SA is often used as a payload in antibody-drug conjugates (ADCs), which are designed to deliver the cytotoxic agent specifically to cancer cells, thereby minimizing toxicity to normal cells and enhancing therapeutic efficacy.
| Catalog Number | M105676 |
| CAS Number | 130288-24-3 |
| Molecular Formula | C25H23N3O7 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | methyl (1R,12S)-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-4-carboxylate |
| InChI | InChI=1S/C25H23N3O7/c1-32-17-6-11-5-14(26-19(11)22(34-3)21(17)33-2)23(30)28-10-12-9-25(12)13-7-15(24(31)35-4)27-20(13)16(29)8-18(25)28/h5-8,12,26-27H,9-10H2,1-4H3/t12-,25-/m1/s1 |
| InChIKey | VQNATVDKACXKTF-XELLLNAOSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C=C(N2)C(=O)N3CC4CC45C3=CC(=O)C6=C5C=C(N6)C(=O)OC)OC)OC |
