For research use only. Not for therapeutic Use.
DY-46-2（Cat No.:I042865）is a novel compound under research for its potential use in cancer therapy. It is a small molecule designed to target specific signaling pathways involved in tumor growth and metastasis. By inhibiting key enzymes and receptors critical for cancer cell survival, DY-46-2 aims to slow down tumor progression and enhance the effectiveness of existing cancer treatments. Preclinical studies suggest that it may have potent anticancer activity, with a focus on solid tumors. DY-46-2 is being investigated for its therapeutic potential in improving outcomes for cancer patients in clinical trials.
| CAS Number | 1105110-83-5 |
| Synonyms | 6-methyl-4-oxo-3-(2-pyrrolidin-1-ylethyl)-N-(6-sulfamoylpyridin-3-yl)furo[2,3-d]pyrimidine-5-carboxamide |
| Molecular Formula | C19H22N6O5S |
| Purity | ≥95% |
| IUPAC Name | 6-methyl-4-oxo-3-(2-pyrrolidin-1-ylethyl)-N-(6-sulfamoylpyridin-3-yl)furo[2,3-d]pyrimidine-5-carboxamide |
| InChI | InChI=1S/C19H22N6O5S/c1-12-15(17(26)23-13-4-5-14(21-10-13)31(20,28)29)16-18(30-12)22-11-25(19(16)27)9-8-24-6-2-3-7-24/h4-5,10-11H,2-3,6-9H2,1H3,(H,23,26)(H2,20,28,29) |
| InChIKey | FAZNWIGAOYXZGW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)N=CN(C2=O)CCN3CCCC3)C(=O)NC4=CN=C(C=C4)S(=O)(=O)N |
