For research use only. Not for therapeutic Use.
Dyrk1A-IN-3（Cat No.:I043437）is a selective inhibitor targeting DYRK1A (Dual-specificity tyrosine phosphorylation-regulated kinase 1A), an enzyme involved in several cellular processes, including cell cycle regulation, neuronal development, and gene expression. Overactivity of DYRK1A has been linked to various neurological disorders, such as Down syndrome and Alzheimer’s disease. By inhibiting DYRK1A, Dyrk1A-IN-3 aims to modulate these pathways, offering potential therapeutic benefits in treating neurodegenerative diseases, cognitive disorders, and developmental syndromes. Ongoing research is focused on assessing its potency, safety, and potential applications in the treatment of these conditions.
| CAS Number | 2493976-27-3 |
| Synonyms | N-methyl-N-(3-methylphenyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| Molecular Formula | C18H16N6 |
| Purity | ≥95% |
| IUPAC Name | N-methyl-N-(3-methylphenyl)-4-pyrazolo[1,5-b]pyridazin-3-ylpyrimidin-2-amine |
| InChI | InChI=1S/C18H16N6/c1-13-5-3-6-14(11-13)23(2)18-19-10-8-16(22-18)15-12-21-24-17(15)7-4-9-20-24/h3-12H,1-2H3 |
| InChIKey | XOBINHQHMGZFDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C)C2=NC=CC(=N2)C3=C4C=CC=NN4N=C3 |
