For research use only. Not for therapeutic Use.
DZD1516(CAT: I040889) is a highly potent and selective HER2 inhibitor with an IC50 of 0.56 nM. It is known for its excellent blood-brain barrier permeability, making it a promising candidate for treating HER2-positive tumors in the central nervous system (CNS). DZD1516 demonstrates significant antitumor activity in both CNS and subcutaneous xenograft mouse models, suggesting its potential in treating HER2-overexpressing cancers, including those with brain metastasis, by effectively targeting and inhibiting HER2 signaling pathways.
| CAS Number | 2387570-00-3 |
| Synonyms | 5-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-7-methoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
| Molecular Formula | C28H27F2N7O3 |
| Purity | ≥95% |
| IUPAC Name | 5-[(4S)-3,3-difluoro-1-methylpiperidin-4-yl]oxy-7-methoxy-N-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)phenyl]quinazolin-4-amine |
| InChI | InChI=1S/C28H27F2N7O3/c1-17-10-18(4-5-22(17)39-19-6-9-37-25(13-19)32-16-34-37)35-27-26-21(31-15-33-27)11-20(38-3)12-23(26)40-24-7-8-36(2)14-28(24,29)30/h4-6,9-13,15-16,24H,7-8,14H2,1-3H3,(H,31,33,35)/t24-/m0/s1 |
| InChIKey | IDQNCHCNBVCUHC-DEOSSOPVSA-N |
| SMILES | CC1=C(C=CC(=C1)NC2=NC=NC3=C2C(=CC(=C3)OC)OC4CCN(CC4(F)F)C)OC5=CC6=NC=NN6C=C5 |
