Home
>
Chemical Reagents>Heterocycles> (E)-2-(2-(cyclohex-1-en-1-yl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
(E)-2-(2-(cyclohex-1-en-1-yl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing compound characterized by a dioxaborolane ring and a cyclohexene moiety. This compound is significant in organic synthesis, particularly in reactions involving cross-coupling and functionalization due to its ability to form stable complexes with transition metals. The unique structure, featuring both vinyl and cyclohexene functionalities, enhances its reactivity and versatility in chemical transformations. Its applications include the synthesis of complex organic molecules and potential use in medicinal chemistry.
Catalog Number | L031194 |
CAS Number | 245432-97-7 |
Molecular Formula | C14H23BO2 |
Purity | ≥95% |
IUPAC Name | 2-[(E)-2-(cyclohexen-1-yl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C14H23BO2/c1-13(2)14(3,4)17-15(16-13)11-10-12-8-6-5-7-9-12/h8,10-11H,5-7,9H2,1-4H3/b11-10+ |
InChIKey | KSZSVSZZECWICY-ZHACJKMWSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CCCCC2 |