Home
>
Chemical Reagents>Organic Building Blocks> (E)-2-(3-Fluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
(E)-2-(3-Fluorostyryl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (Cat.No:L003620) is a significant compound in materials science and pharmaceutical research. Its distinctive structure, featuring a boron-containing motif and a fluorostyryl group, makes it a valuable building block for the synthesis of specialized materials and potential drug candidates. This compound’s versatile reactivity and potential applications highlight its importance in contemporary chemical research
CAS Number | 633327-36-3 |
Molecular Formula | C14H18BFO2 |
Purity | ≥95% |
IUPAC Name | 2-[(E)-2-(3-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C14H18BFO2/c1-13(2)14(3,4)18-15(17-13)9-8-11-6-5-7-12(16)10-11/h5-10H,1-4H3/b9-8+ |
InChIKey | XKOFTHAMHDHSMB-CMDGGOBGSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C2=CC(=CC=C2)F |