For research use only. Not for therapeutic Use.
(E)-2-Decenoic Acid(CAT: I003214) is an unsaturated medium-chain fatty acid characterized by a trans double bond at the second carbon position. It is studied for its potential antimicrobial and bioactive properties, showing inhibitory effects against various bacterial and fungal pathogens. Additionally, (E)-2-Decenoic acid has been explored for its role in biofilm inhibition and quorum sensing disruption, making it valuable in microbiology and infection control research. Its structural similarity to naturally occurring fatty acids also suggests potential applications in metabolic and lipid signaling studies, contributing to the development of novel antimicrobial and therapeutic strategies.
CAS Number | 334-49-6 |
Synonyms | (E)-dec-2-enoic acid |
Molecular Formula | C10H18O2 |
Purity | ≥95% |
Target | Estrogen/progestogen Receptor |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | (E)-dec-2-enoic acid |
InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/b9-8+ |
InChIKey | WXBXVVIUZANZAU-CMDGGOBGSA-N |
SMILES | CCCCCCC/C=C/C(=O)O |