For research use only. Not for therapeutic Use.
(E)-(3-(Benzyloxy)prop-1-en-1-yl)boronic acid (CAT: L000168) is a valuable chemical compound with diverse applications in organic chemistry and pharmaceutical research. Its action mechanism involves acting as a boronic acid derivative, making it an essential building block for various chemical reactions. In the realm of organic chemistry, it serves as a versatile intermediate for the synthesis of pharmaceutical compounds and agrochemicals.
CAS Number | 220194-16-1 |
Molecular Formula | C10H13BO3 |
Purity | ≥95% |
IUPAC Name | [(E)-3-phenylmethoxyprop-1-enyl]boronic acid |
InChI | InChI=1S/C10H13BO3/c12-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h1-7,12-13H,8-9H2/b7-4+ |
InChIKey | JLRNXBJMZCDPTE-QPJJXVBHSA-N |