For research use only. Not for therapeutic Use.
(E)-3-(m-Tolyl)acrylaldehyde is an organic compound featuring an acrylic aldehyde functional group with a meta-tolyl substituent. The (E) configuration indicates a trans arrangement around the double bond, which impacts its reactivity and potential applications in synthesis. This compound is valuable in organic chemistry for its ability to undergo various reactions, such as condensation and addition. The presence of the aromatic m-tolyl group can enhance its lipophilicity, making it of interest in the development of pharmaceuticals and other bioactive materials.
CAS Number | 93614-80-3 |
Molecular Formula | C10H10O |
Purity | ≥95% |
IUPAC Name | (E)-3-(3-methylphenyl)prop-2-enal |
InChI | InChI=1S/C10H10O/c1-9-4-2-5-10(8-9)6-3-7-11/h2-8H,1H3/b6-3+ |
InChIKey | SJLLZWMNPJCLBC-ZZXKWVIFSA-N |
SMILES | CC1=CC(=CC=C1)/C=C/C=O |