For research use only. Not for therapeutic Use.
(E)-4-(Dimethylamino)but-2-enoic acid (Cat.No:M098873) is a chemical compound with potential pharmaceutical significance. Its unique structure, featuring a conjugated system with a dimethylamino group, suggests potential bioactivity. Further research is needed to explore its specific properties and applications in medicinal chemistry and related fields.
CAS Number | 149586-32-3 |
Synonyms | (2E)-4-(Dimethylamino)but-2-enoic acid; (E)-4-(dimethylamino)but-2-enoic acid |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | (E)-4-(dimethylamino)but-2-enoic acid |
InChI | InChI=1S/C6H11NO2/c1-7(2)5-3-4-6(8)9/h3-4H,5H2,1-2H3,(H,8,9)/b4-3+ |
InChIKey | ITGIYLMMAABTHC-ONEGZZNKSA-N |
SMILES | CN(C)CC=CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |