For research use only. Not for therapeutic Use.
(E)-4-Phenyl-3-buten-2-one(Cat No.:M119945), also known as benzylideneacetone, is a compound with a chemical structure containing a phenyl ring attached to a butanone moiety. It exists as a pale yellow liquid with a strong odor. This compound is used in the synthesis of various organic compounds and as a flavoring agent in the food industry. (E)-4-Phenyl-3-buten-2-one is also employed in the production of fragrances and perfumes due to its pleasant aroma. Additionally, it has been studied for its potential biological activities, including antioxidant and antimicrobial properties.
CAS Number | 1896-62-4 |
Molecular Formula | C10H10O |
Purity | ≥95% |
Target | Phospholipase |
Storage | -20°C |
IUPAC Name | (E)-4-phenylbut-3-en-2-one |
InChI | InChI=1S/C10H10O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-8H,1H3/b8-7+ |
InChIKey | BWHOZHOGCMHOBV-BQYQJAHWSA-N |
SMILES | CC(=O)C=CC1=CC=CC=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |