Home
>
Chemical Reagents>Organometallic Reagents> (E)-4,4,5,5-tetramethyl-2-(3-phenylprop-1-en-1-yl)-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
(E)-4,4,5,5-tetramethyl-2-(3-phenylprop-1-en-1-yl)-1,3,2-dioxaborolane(Cat No.:L007248), is a versatile chemical compound utilized in organic synthesis and medicinal chemistry research. Its molecular formula is C15H21BO2. This compound, featuring a boron atom within a dioxaborolane ring and a phenylpropenyl group, serves as a valuable reagent in Suzuki-Miyaura cross-coupling reactions. The presence of the boron atom enhances its reactivity, allowing for efficient synthesis of complex organic molecules. Researchers employ it as a building block for the creation of pharmaceuticals, agrochemicals, and advanced materials. Its selective reactivity and compatibility with various functional groups make it crucial in the development of novel compounds.
CAS Number | 177573-86-3 |
Molecular Formula | C15H21BO2 |
Purity | ≥95% |
IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-3-phenylprop-1-enyl]-1,3,2-dioxaborolane |
InChI | InChI=1S/C15H21BO2/c1-14(2)15(3,4)18-16(17-14)12-8-11-13-9-6-5-7-10-13/h5-10,12H,11H2,1-4H3/b12-8+ |
InChIKey | YIABKORCFFPVSM-XYOKQWHBSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C=CCC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |