For research use only. Not for therapeutic Use.
(E)-6-Amino-2-hexenoic acid hydrochloride is a chemical compound consisting of an amino acid with a specific geometric isomer configuration. This compound is used in biochemical and pharmaceutical research due to its role as a building block for peptide synthesis and drug development. The hydrochloride salt form enhances its stability and solubility in aqueous solutions, facilitating experimental applications. (E)-6-Amino-2-hexenoic acid hydrochloride is valuable in studying enzyme-substrate interactions and designing therapeutic agents targeting specific biological pathways.
CAS Number | 19991-88-9 |
Synonyms | (2E)-6-Amino-2-hexenoic Acid Hydrochloride; (E)-6-Aminohex-2-enoic Acid Hydrochloride; |
Molecular Formula | C6H12ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-6-aminohex-2-enoic acid;hydrochloride |
InChI | InChI=1S/C6H11NO2.ClH/c7-5-3-1-2-4-6(8)9;/h2,4H,1,3,5,7H2,(H,8,9);1H/b4-2+; |
InChIKey | OULZEYQKBDXFKX-VEELZWTKSA-N |
SMILES | C(CC=CC(=O)O)CN.Cl |