For research use only. Not for therapeutic Use.
E-982 is a steroid used for the on-line screening of the DNA unwinding element binding protein (DUE-B) immobilized protein column[1].
The DNA unwinding element binding protein (DUE-B) plays a key role in DNA replication. The DUE-B/CLC-L phase can be used for on-line pharmacological studies[1].
| Catalog Number | I005157 |
| CAS Number | 858102-78-0 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 3-[[(8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]sulfanyl]propanoate |
| Molecular Formula | C25H31NO6S |
| Purity | ≥95% |
| InChI | InChI=1S/C25H31NO6S/c1-25-10-8-17-16-3-2-15(27)12-14(16)13-19(24(17)18(25)4-5-20(25)28)33-11-9-23(31)32-26-21(29)6-7-22(26)30/h2-3,12,17-20,24,27-28H,4-11,13H2,1H3/t17-,18+,19?,20+,24-,25+/m1/s1 |
| InChIKey | KUHPCTPVWHBMRF-BVUARCABSA-N |
| SMILES | CC12CCC3C(C1CCC2O)C(CC4=C3C=CC(=C4)O)SCCC(=O)ON5C(=O)CCC5=O |
| Reference | [1]. Moaddel R, et al. The synthesis and initial characterization of an immobilized DNA unwinding element binding (DUE-B) protein chromatographic stationary phase. J Chromatogr B Analyt Technol Biomed Life Sci. 2005 Jun 25;820(2):197-203. |
