For research use only. Not for therapeutic Use.
(E)-Alprenoxime(CAT: I013565) is a potent inhibitor primarily utilized in cardiovascular research. It is known for its role in modulating beta-adrenergic receptor activity, making it a valuable tool in studying cardiovascular signaling pathways and potential therapeutic applications. This compound supports advanced research into heart rate regulation, blood pressure control, and myocardial function, offering insights essential for developing innovative treatments for cardiovascular diseases. With high purity and reliable performance, (E)-Alprenoxime is an indispensable resource for researchers focusing on cardiovascular health and therapeutic advancements.
| Catalog Number | I013565 |
| CAS Number | 125720-84-5 |
| Molecular Formula | C₁₅H₂₂N₂O₂ |
| Purity | ≥95% |
| Target | Others |
| Solubility | DMSO |
| IUPAC Name | (NE)-N-[1-(propan-2-ylamino)-3-(2-prop-2-enylphenoxy)propan-2-ylidene]hydroxylamine |
| InChI | InChI=1S/C15H22N2O2/c1-4-7-13-8-5-6-9-15(13)19-11-14(17-18)10-16-12(2)3/h4-6,8-9,12,16,18H,1,7,10-11H2,2-3H3/b17-14+ |
| InChIKey | XFQFSSGNEFUEPA-SAPNQHFASA-N |
| SMILES | CC(C)NCC(=NO)COC1=CC=CC=C1CC=C |
