For research use only. Not for therapeutic Use.
(E)-Cefixime, also known as Cefixime EP Impurity D, is a geometric isomer of cefixime, a third-generation cephalosporin antibiotic used to treat a wide range of bacterial infections. This specific form, characterized by its (E)-configuration, arises during the synthesis of cefixime and is considered an impurity in the pharmaceutical formulation. Monitoring and controlling the levels of such impurities are crucial to ensure the safety and efficacy of the drug in clinical use.
Catalog Number | R057239 |
CAS Number | 97164-56-2 |
Synonyms | (6R,7R)-7-[[(2E)-2-(2-Amino-4-thiazolyl)-2-[(carboxymethoxy)imino]acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid; Cefixime E-isomer; [6R-[6α,7β(E)]]-7-[[(2-Amino-4-thiazolyl)[(carboxymethoxy)imino]acetyl]amino]-3 |
Molecular Formula | C16H15N5O7S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (6R,7R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(carboxymethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C16H15N5O7S2/c1-2-6-4-29-14-10(13(25)21(14)11(6)15(26)27)19-12(24)9(20-28-3-8(22)23)7-5-30-16(17)18-7/h2,5,10,14H,1,3-4H2,(H2,17,18)(H,19,24)(H,22,23)(H,26,27)/b20-9+/t10-,14-/m1/s1 |
InChIKey | OKBVVJOGVLARMR-VINNURBNSA-N |
SMILES | C=CC1=C(N2C(C(C2=O)NC(=O)C(=NOCC(=O)O)C3=CSC(=N3)N)SC1)C(=O)O |