For research use only. Not for therapeutic Use.
(E)-Ceftibuten dihydrate is a third-generation cephalosporin antibiotic used to treat various bacterial infections, including respiratory tract infections, otitis media, and urinary tract infections. It works by inhibiting bacterial cell wall synthesis, leading to cell death. The dihydrate form ensures stability and solubility for oral administration. Research on (E)-Ceftibuten dihydrate focuses on its pharmacokinetics, efficacy, safety profile, and potential to combat antibiotic-resistant bacteria, aiming to optimize its clinical use and therapeutic outcomes.
Catalog Number | R047033 |
CAS Number | 97519-40-9 |
Synonyms | [6R-[6α,7β(E)]]-7-[[2-(2-Amino-4-thiazolyl)-4-carboxy-1-oxo-2-butenyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid Dihydrate; |
Molecular Formula | C15H14N4O6S2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | (6R,7R)-7-[[(E)-2-(2-amino-1,3-thiazol-4-yl)-4-carboxybut-2-enoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
InChI | InChI=1S/C15H14N4O6S2/c16-15-17-7(5-27-15)6(1-2-9(20)21)11(22)18-10-12(23)19-8(14(24)25)3-4-26-13(10)19/h1,3,5,10,13H,2,4H2,(H2,16,17)(H,18,22)(H,20,21)(H,24,25)/b6-1+/t10-,13-/m1/s1 |
InChIKey | UNJFKXSSGBWRBZ-VTSZRNMSSA-N |
SMILES | C1C=C(N2C(S1)C(C2=O)NC(=O)C(=CCC(=O)O)C3=CSC(=N3)N)C(=O)O |