For research use only. Not for therapeutic Use.
(E)-Fenpyroximate（Cat No.:M108468）is a selective insecticide that targets the mitochondrial respiratory chain of pests, specifically inhibiting the activity of complex I. This compound is particularly effective against acaricide-resistant mites and other arthropod pests, making it valuable in agricultural pest management. (E)-Fenpyroximate works by disrupting the energy production in pest cells, leading to their paralysis and eventual death. Its targeted mechanism of action helps reduce harm to beneficial insects and minimize environmental impact compared to other pesticides.
| CAS Number | 134098-61-6 |
| Synonyms | tert-butyl 4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoate |
| Molecular Formula | C24H27N3O4 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoate |
| InChI | InChI=1S/C24H27N3O4/c1-17-21(22(27(5)26-17)30-20-9-7-6-8-10-20)15-25-29-16-18-11-13-19(14-12-18)23(28)31-24(2,3)4/h6-15H,16H2,1-5H3/b25-15+ |
| InChIKey | YYJNOYZRYGDPNH-MFKUBSTISA-N |
| SMILES | CC1=NN(C(=C1/C=N/OCC2=CC=C(C=C2)C(=O)OC(C)(C)C)OC3=CC=CC=C3)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
