Home
>
Chemical Reagents>Heterocyclic Building Blocks> (E)-methyl 1-acetyl-3-(methoxy(phenyl)methylene)-2-oxoindoline-6-carboxylate
For research use only. Not for therapeutic Use.
(E)-Methyl 1-acetyl-3-(methoxy(phenyl)methylene)-2-oxoindoline-6-carboxylate is an organic compound featuring an indoline framework with various functional groups. It has a methyl ester, an acetyl group, and a methoxy-substituted phenyl moiety in a (E)-configuration. Its chemical formula is C₂₁H₁₉NO₄. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. The unique structure allows for diverse chemical transformations, making it a valuable scaffold for drug development and synthetic organic chemistry.
CAS Number | 1168152-07-5 |
Molecular Formula | C20H17NO5 |
Purity | ≥95% |
IUPAC Name | methyl (3E)-1-acetyl-3-[methoxy(phenyl)methylidene]-2-oxoindole-6-carboxylate |
InChI | InChI=1S/C20H17NO5/c1-12(22)21-16-11-14(20(24)26-3)9-10-15(16)17(19(21)23)18(25-2)13-7-5-4-6-8-13/h4-11H,1-3H3/b18-17+ |
InChIKey | IAELOHNWFVWCNO-ISLYRVAYSA-N |
SMILES | CC(=O)N1C2=C(C=CC(=C2)C(=O)OC)/C(=C(/C3=CC=CC=C3)\OC)/C1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |