For research use only. Not for therapeutic Use.
(E)-Methyl 3-(2-bromophenyl)acrylate(Cat No.:L026423)is a chemical compound with the molecular formula C11H11BrO2. It features an acrylate ester linked to a 2-bromophenyl group in a trans configuration. This structure is pivotal in the synthesis of polymers, coatings, and adhesives due to its double bond, which facilitates polymerization reactions. The bromophenyl group also enhances its reactivity in cross-coupling reactions, making it valuable in creating complex organic molecules used in pharmaceuticals and advanced materials. Its applications extend to the development of high-performance plastics and resins with specific physical properties.
CAS Number | 92991-89-4 |
Molecular Formula | C10H9BrO2 |
Purity | ≥95% |
IUPAC Name | methyl (E)-3-(2-bromophenyl)prop-2-enoate |
InChI | InChI=1S/C10H9BrO2/c1-13-10(12)7-6-8-4-2-3-5-9(8)11/h2-7H,1H3/b7-6+ |
InChIKey | YIHZPTVKKKVMHT-VOTSOKGWSA-N |
SMILES | COC(=O)/C=C/C1=CC=CC=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |