Home
>
Isotope Labeled Compounds>Isotope Labeled Metabolites> (E)-N-(3-(3-(Dimethylamino)acryloyl)phenyl)-N-ethylacetamide-d5
For research use only. Not for therapeutic Use.
(E)-N-(3-(3-(Dimethylamino)acryloyl)phenyl)-N-ethylacetamide-d5 is a deuterated form of a synthetic compound used in advanced chemical research. This molecule features five deuterium atoms, enhancing its stability and making it particularly useful for isotope-dilution mass spectrometry, pharmacokinetic studies, and drug metabolism research. The deuterium atoms allow for precise tracking in complex biological systems, making this compound valuable in studying the behavior and interaction of similar acrylamide derivatives in various chemical and biological contexts. (E)-N-(3-(3-(Dimethylamino)acryloyl)phenyl)-N-ethylacetamide-d5 is essential for achieving accurate and reproducible results in analytical chemistry, particularly in research focused on synthetic organic compounds and their potential applications in pharmaceuticals.
CAS Number | 1104483-92-2 |
Synonyms | N-[3-[(2E)-3-(Dimethylamino)-1-oxo-2-propen-1-yl]phenyl]-N-ethyl-acetamide-d5 |
Molecular Formula | C₁₅H₁₅D₅N₂O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-(1,1,2,2,2-pentadeuterioethyl)acetamide |
InChI | InChI=1S/C15H20N2O2/c1-5-17(12(2)18)14-8-6-7-13(11-14)15(19)9-10-16(3)4/h6-11H,5H2,1-4H3/b10-9+/i1D3,5D2 |
InChIKey | UXWJJVRASIHSQS-CZIVGBDRSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])N(C1=CC=CC(=C1)C(=O)/C=C/N(C)C)C(=O)C |