For research use only. Not for therapeutic Use.
(E)-p-Coumaryl Alcohol(CAT: I040863) is a naturally occurring phenylpropanoid and a key precursor in lignin biosynthesis. It plays a crucial role in plant cell wall formation and structural integrity. This bioactive compound exhibits antioxidant, antimicrobial, and anti-inflammatory properties, making it valuable in plant biology, pharmaceutical research, and biomaterial development. Additionally, (E)-p-Coumaryl Alcohol is studied for its potential applications in metabolic and enzymatic pathway research related to lignin polymerization. Its role in plant-derived polyphenol pathways also makes it a relevant compound in food science and natural product chemistry.
CAS Number | 20649-40-5 |
Synonyms | 4-[(E)-3-hydroxyprop-1-enyl]phenol |
Molecular Formula | C9H10O2 |
Purity | ≥95% |
IUPAC Name | 4-[(E)-3-hydroxyprop-1-enyl]phenol |
InChI | InChI=1S/C9H10O2/c10-7-1-2-8-3-5-9(11)6-4-8/h1-6,10-11H,7H2/b2-1+ |
InChIKey | PTNLHDGQWUGONS-OWOJBTEDSA-N |
SMILES | C1=CC(=CC=C1C=CCO)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |