For research use only. Not for therapeutic Use.
(E)-Pyrminobac-methyl（Cat No.:M093625）, is a chemical compound used as a herbicide in agricultural applications. It belongs to the class of herbicides known as pyrimidinyl benzoates. This herbicide is specifically effective against certain grassy weed species, making it valuable for crop protection in various agricultural settings. (E)-Pyrminobac-methyl works by inhibiting the growth of undesirable grasses, allowing cultivated crops to thrive without competition. Its selectivity for grassy weeds makes it a useful tool for weed control in crops like wheat and barley.
| Catalog Number | M093625 |
| CAS Number | 147411-69-6 |
| Molecular Formula | C17H19N3O6 |
| Purity | ≥95% |
| Storage | 0-6°C |
| IUPAC Name | methyl 2-(4,6-dimethoxypyrimidin-2-yl)oxy-6-[(E)-N-methoxy-C-methylcarbonimidoyl]benzoate |
| InChI | InChI=1S/C17H19N3O6/c1-10(20-25-5)11-7-6-8-12(15(11)16(21)24-4)26-17-18-13(22-2)9-14(19-17)23-3/h6-9H,1-5H3/b20-10+ |
| InChIKey | USSIUIGPBLPCDF-KEBDBYFISA-N |
| SMILES | CC(=NOC)C1=C(C(=CC=C1)OC2=NC(=CC(=N2)OC)OC)C(=O)OC |
