For research use only. Not for therapeutic Use.
(E/Z)-ZINC09659342（Cat No.:I043570）is a small molecule identified in the ZINC database, a collection of compounds used in drug discovery and molecular research. This compound is characterized by its (E/Z) isomerism, meaning it exists in two different geometric configurations based on the orientation of functional groups around a double bond. (E/Z)-ZINC09659342 may serve as a potential lead compound in various therapeutic areas, such as oncology or inflammation, though its specific bioactivity requires further study. The compound’s structural features make it a promising candidate for further development in medicinal chemistry.
| CAS Number | 591726-26-0 |
| Synonyms | 4-[(4E)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid |
| Molecular Formula | C23H15F3N2O4 |
| Purity | ≥95% |
| IUPAC Name | 4-[(4E)-3-methyl-5-oxo-4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]pyrazol-1-yl]benzoic acid |
| InChI | InChI=1S/C23H15F3N2O4/c1-13-19(21(29)28(27-13)17-7-5-14(6-8-17)22(30)31)12-18-9-10-20(32-18)15-3-2-4-16(11-15)23(24,25)26/h2-12H,1H3,(H,30,31)/b19-12+ |
| InChIKey | SFVRJPWNVAZKMP-XDHOZWIPSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C/C2=CC=C(O2)C3=CC(=CC=C3)C(F)(F)F)C4=CC=C(C=C4)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
