For research use only. Not for therapeutic Use.
E235（Cat No.:I012666）is an investigational compound developed for the treatment of various cancers, particularly those resistant to conventional therapies. It functions by inhibiting specific enzymes and signaling pathways involved in cancer cell growth, survival, and metastasis. By targeting these key molecular mechanisms, E235 aims to suppress tumor progression and improve the effectiveness of existing cancer treatments. Preclinical studies have shown that E235 can selectively target tumor cells while sparing healthy tissues, offering the potential for a more targeted and less toxic therapeutic approach in oncology. Early research suggests promising efficacy across several cancer types.
| CAS Number | 891894-69-2 |
| Synonyms | N-(1-benzylpiperidin-4-yl)-2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| Molecular Formula | C28H25FN4OS |
| Purity | ≥95% |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-(4-fluorophenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| InChI | InChI=1S/C28H25FN4OS/c29-22-9-6-20(7-10-22)24-18-33-25-11-8-21(16-26(25)35-28(33)31-24)27(34)30-23-12-14-32(15-13-23)17-19-4-2-1-3-5-19/h1-11,16,18,23H,12-15,17H2,(H,30,34) |
| InChIKey | SNVVZJBHCSPRGY-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)C2=CC3=C(C=C2)N4C=C(N=C4S3)C5=CC=C(C=C5)F)CC6=CC=CC=C6 |
