For research use only. Not for therapeutic Use.
E3 Ligase Ligand 23（Cat No.:I043866）is a small molecule that selectively targets E3 ubiquitin ligases, enzymes responsible for tagging proteins for degradation by the proteasome. By modulating the activity of specific E3 ligases, this compound can influence various cellular pathways, including protein quality control, signal transduction, and cell cycle regulation. E3 Ligase Ligand 23 is being studied for its potential to treat diseases associated with protein misfolding and dysregulation, such as cancer and neurodegenerative disorders. It offers promise as a tool in targeted protein degradation and therapeutic development.
| CAS Number | 444287-56-3 |
| Synonyms | 4-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| Molecular Formula | C20H17N3O4 |
| Purity | ≥95% |
| IUPAC Name | 4-(benzylamino)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChI | InChI=1S/C20H17N3O4/c24-16-10-9-15(18(25)22-16)23-19(26)13-7-4-8-14(17(13)20(23)27)21-11-12-5-2-1-3-6-12/h1-8,15,21H,9-11H2,(H,22,24,25) |
| InChIKey | JBYQCGLMICPOSQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NCC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
