For research use only. Not for therapeutic Use.
E3 ligase Ligand-Linker Conjugate 6 (CAT: I013196) is a compound designed as a conjugate of an E3 ligase ligand and a linker molecule. The E3 ligase ligand portion of the conjugate selectively binds to a specific E3 ligase protein, which plays a crucial role in the ubiquitin-proteasome system and protein degradation. By targeting E3 ligases, these conjugates aim to modulate the ubiquitination and subsequent degradation of specific target proteins, offering potential therapeutic applications in the field of targeted protein degradation. The linker molecule provides stability and flexibility between the ligand and the target protein.
CAS Number | 2097973-72-1 |
Molecular Formula | C₂₈H₄₂ClN₅O₆S |
Purity | ≥95% |
Target | E3 Ligase Ligand-Linker Conjugates |
Solubility | DMSO |
IUPAC Name | (2S,4R)-1-[(2S)-2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-3,3-dimethylbutanoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide;hydrochloride |
InChI | InChI=1S/C28H41N5O6S.ClH/c1-18-24(40-17-31-18)20-7-5-19(6-8-20)14-30-26(36)22-13-21(34)15-33(22)27(37)25(28(2,3)4)32-23(35)16-39-12-11-38-10-9-29;/h5-8,17,21-22,25,34H,9-16,29H2,1-4H3,(H,30,36)(H,32,35);1H/t21-,22+,25-;/m1./s1 |
InChIKey | SYAOHFUUVWFWJH-ZBXLSASTSA-N |
SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)CNC(=O)C3CC(CN3C(=O)C(C(C)(C)C)NC(=O)COCCOCCN)O.Cl |