For research use only. Not for therapeutic Use.
E7016(CAT: I006572), also known as GPI-15427, is a potent poly (ADP-ribose) polymerase (PARP) inhibitor that has been studied for its potential in cancer therapy. By inhibiting PARP enzymes, which play a crucial role in DNA repair, E7016 enhances the accumulation of DNA damage in cancer cells, leading to cell death, particularly in tumors with defective DNA repair mechanisms, such as those with BRCA1/2 mutations. E7016 is being investigated for its ability to enhance the efficacy of chemotherapy and radiotherapy by sensitizing cancer cells to these treatments. Its potential as a targeted therapy makes it valuable in research focused on advancing treatments for cancers like breast, ovarian, and prostate cancer.
| Catalog Number | I006572 |
| CAS Number | 902128-92-1 |
| Synonyms | E7016; E-7016; E 7016; GPI21016; GPI 21016; GPI-21016.;10-((4-Hydroxypiperidin-1-yl)methyl)chromeno[4,3,2-de]phthalazin-3(2H)-one |
| Molecular Formula | C20H19N3O3 |
| Purity | ≥95% |
| Target | Epigenetics |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term or -20 °C for long term |
| InChI | InChI=1S/C20H19N3O3/c24-13-6-8-23(9-7-13)11-12-4-5-16-15(10-12)19-18-14(20(25)22-21-19)2-1-3-17(18)26-16/h1-5,10,13,24H,6-9,11H2,(H,22,25) |
| InChIKey | HAVFFEMDLROBGI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1O)CC2=CC3=C(C=C2)OC4=CC=CC5=C4C3=NNC5=O |
