For research use only. Not for therapeutic Use.
EAI001 (CAT: I026661) is a notable compound as it was the first non-ATP competitive inhibitor developed specifically to target the epidermal growth factor receptor (EGFR) mutations L858R, T790M, and C797S. These mutations are commonly found in EGFR-mutant non-small cell lung cancer (NSCLC) and are associated with resistance to traditional EGFR inhibitors. EAI001 was designed to bind to EGFR in a manner that is distinct from ATP binding, allowing it to overcome the resistance caused by these specific mutations. By selectively targeting these mutations, EAI001 demonstrated promising preclinical activity and provided a basis for the development of subsequent generations of non-ATP competitive EGFR inhibitors for the treatment of EGFR-mutant NSCLC.
| Catalog Number | I026661 |
| CAS Number | 892772-75-7 |
| Synonyms | EAI001; EAI-001; EAI 001; |
| Molecular Formula | C19H15N3O2S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 2-(1-oxoisoindolin-2-yl)-2-phenyl-N-(thiazol-2-yl)acetamide |
| InChI | InChI=1S/C19H15N3O2S/c23-17(21-19-20-10-11-25-19)16(13-6-2-1-3-7-13)22-12-14-8-4-5-9-15(14)18(22)24/h1-11,16H,12H2,(H,20,21,23) |
| InChIKey | PWRVRDCBFYLYFU-UHFFFAOYSA-N |
| SMILES | O=C(NC1=NC=CS1)C(N(CC2=C3C=CC=C2)C3=O)C4=CC=CC=C4 |
| Reference | 1: Wan S, Yan R, Jiang Y, Li Z, Wu X. Insight into Binding Mechanisms of EGFR |
