For research use only. Not for therapeutic Use.
EAI045 (CAT: I013761) is an allosteric inhibitor specifically designed to target certain drug-resistant mutants of the epidermal growth factor receptor (EGFR). It is effective against EGFR mutations such as T790M, which are commonly associated with resistance to EGFR-targeted therapies in non-small cell lung cancer (NSCLC) patients. By binding to the allosteric site of the mutant EGFR, EAI045 inhibits the signaling pathways involved in cancer cell growth and survival. This targeted inhibition offers a potential therapeutic strategy for overcoming resistance to EGFR inhibitors and improving treatment outcomes in patients with drug-resistant EGFR mutations.
| Catalog Number | I013761 |
| CAS Number | 1942114-09-1 |
| Molecular Formula | C39H14FN3O3S |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 28 mg/mL |
| IUPAC Name | 2-(5-fluoro-2-hydroxyphenyl)-2-(3-oxo-1H-isoindol-2-yl)-N-(1,3-thiazol-2-yl)acetamide |
| InChI | InChI=1S/C19H14FN3O3S/c20-12-5-6-15(24)14(9-12)16(17(25)22-19-21-7-8-27-19)23-10-11-3-1-2-4-13(11)18(23)26/h1-9,16,24H,10H2,(H,21,22,25) |
| InChIKey | YTUFHOKUFOQRDF-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)N1C(C3=C(C=CC(=C3)F)O)C(=O)NC4=NC=CS4 |
