For research use only. Not for therapeutic Use.
EAPB 02303（Cat No.:I041279）is a novel small molecule compound being studied for its potential therapeutic applications in oncology and immunology. It is an inhibitor targeting specific protein pathways involved in cancer cell growth and immune response regulation. EAPB 02303 works by modulating immune system activity, potentially enhancing the body’s ability to fight cancer cells. Preclinical studies have demonstrated its ability to reduce tumor growth and promote an anti-tumor immune response. Ongoing research is focused on evaluating its efficacy, safety, and potential as a targeted treatment for cancer and autoimmune diseases.
| CAS Number | 1958290-51-1 |
| Synonyms | 4-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
| Molecular Formula | C17H14N4O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[4-(methylamino)imidazo[1,2-a]quinoxalin-1-yl]benzene-1,2-diol |
| InChI | InChI=1S/C17H14N4O2/c1-18-16-17-19-9-13(10-6-7-14(22)15(23)8-10)21(17)12-5-3-2-4-11(12)20-16/h2-9,22-23H,1H3,(H,18,20) |
| InChIKey | KOBYYHFBTUBHRR-UHFFFAOYSA-N |
| SMILES | CNC1=NC2=CC=CC=C2N3C1=NC=C3C4=CC(=C(C=C4)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
