For research use only. Not for therapeutic Use.
Ebaresdax (ACP-044) can inhibit peroxynitrite oxidation derived by SIN-1 and peroxynitrite mediated Cytotoxicity with IC50s of 3.7±0.80 and 0.13±0.02 uM, respectively[1].
| Catalog Number | I026666 |
| CAS Number | 1334471-39-4 |
| Synonyms | (4R)-2-(2-hydroxyanilino)-5,5-dimethyl-4H-1,3-thiazole-4-carboxylic acid |
| Molecular Formula | C12H14N2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C12H14N2O3S/c1-12(2)9(10(16)17)14-11(18-12)13-7-5-3-4-6-8(7)15/h3-6,9,15H,1-2H3,(H,13,14)(H,16,17)/t9-/m1/s1 |
| InChIKey | OASISJWJIHWVKX-SECBINFHSA-N |
| SMILES | CC1(C(N=C(S1)NC2=CC=CC=C2O)C(=O)O)C |
| Reference | [1]. Mannion, James C.; Dax, Scott L. Analgesic compounds, compositions, and uses thereof. WO2011112602A1 |
