For research use only. Not for therapeutic Use.
Ebeiedinone, a steroidal alkaloid from Fritillaria species, inhibits the bioactivity of human whole blood cholinesterase (ChE) at the concentration of 0.1 mM, with the inhibitory effects of 69.0%[1].
Ebeiedinone has both anti-red blood cell (RBC) AChE and anti-plasma BChE activities[1].
| Catalog Number | I015071 |
| CAS Number | 25650-68-4 |
| Synonyms | (1R,2S,6S,9S,10R,11S,14S,15S,18S,20S,23R,24S)-20-hydroxy-6,10,23-trimethyl-4-azahexacyclo[12.11.0.02,11.04,9.015,24.018,23]pentacosan-17-one |
| Molecular Formula | C27H43NO2 |
| Purity | ≥95% |
| InChI | InChI=1S/C27H43NO2/c1-15-4-7-25-16(2)18-5-6-19-20(22(18)14-28(25)13-15)11-23-21(19)12-26(30)24-10-17(29)8-9-27(23,24)3/h15-25,29H,4-14H2,1-3H3/t15-,16+,17-,18+,19+,20+,21-,22+,23-,24+,25-,27+/m0/s1 |
| InChIKey | MWBJDDYEYGDWCZ-UWGLCIHQSA-N |
| SMILES | CC1CCC2C(C3CCC4C(C3CN2C1)CC5C4CC(=O)C6C5(CCC(C6)O)C)C |
| Reference | [1]. Bao-Qin Lin, et al. Inhibitors of Acetylcholine Esterase in Vitro–Screening of Steroidal Alkaloids From Fritillaria Species. Planta Med. 2006 Jul;72(9):814-8. |
