For research use only. Not for therapeutic Use.
Ebio1 is a potent and highly selective KCNQ2 activator. Ebio1 engages the KCNQ2 activation by generating an extended channel gate with a larger conductance at the saturating voltage (+50 mV).
Keywords: Ebio1 | Supplier | KCNQ2 activator | Ebio 1 | Ebio-1 | CAS [339287-36-4] | Potassium | Kv7.2 | Inhibitor | Ion Channels | Epilepsy | Pain | Aged-related sleep disruption | Depressive disorder | Schizophrenia | Amyotrophic lateral sclerosis
| Catalog Number | I047732 |
| CAS Number | 339287-36-4 |
| Molecular Formula | C19H14FNO |
| Purity | ≥95% |
| IUPAC Name | N-(1,2-dihydroacenaphthylen-5-yl)-4-fluorobenzamide |
| InChI | InChI=1S/C19H14FNO/c20-15-9-6-14(7-10-15)19(22)21-17-11-8-13-5-4-12-2-1-3-16(17)18(12)13/h1-3,6-11H,4-5H2,(H,21,22) |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)NC(=O)C4=CC=C(C=C4)F |
| Reference | S Zhang et al. A small-molecule activation mechanism that directly opens the KCNQ2 channel. Nat Chem Biol. 2024 Jul;20(7):847-856. |
