For research use only. Not for therapeutic Use.
EBNA1-IN-SC7(Cat No.:I042944)is a small molecule inhibitor designed to target the Epstein-Barr virus (EBV) nuclear antigen 1 (EBNA1), a key protein involved in the persistence and replication of EBV in infected cells. EBNA1 plays a crucial role in the virus’s ability to maintain its genome within host cells, contributing to the development of EBV-related cancers, such as lymphoma and nasopharyngeal carcinoma. EBNA1-IN-SC7 is being investigated for its potential to disrupt EBNA1 function, thereby reducing viral load and limiting EBV-associated tumor growth. It shows promise as a therapeutic option for EBV-related diseases.
CAS Number | 324022-08-4 |
Synonyms | [4-[acetyl(naphthalen-2-ylsulfonyl)amino]-2-bromophenyl] acetate |
Molecular Formula | C20H16BrNO5S |
Purity | ≥95% |
IUPAC Name | [4-[acetyl(naphthalen-2-ylsulfonyl)amino]-2-bromophenyl] acetate |
InChI | InChI=1S/C20H16BrNO5S/c1-13(23)22(17-8-10-20(19(21)12-17)27-14(2)24)28(25,26)18-9-7-15-5-3-4-6-16(15)11-18/h3-12H,1-2H3 |
InChIKey | SSARAOHVKXASDW-UHFFFAOYSA-N |
SMILES | CC(=O)N(C1=CC(=C(C=C1)OC(=O)C)Br)S(=O)(=O)C2=CC3=CC=CC=C3C=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |