For research use only. Not for therapeutic Use.
Ebselen(Cat No.:I004298)is an organoselenium compound with antioxidant, anti-inflammatory, and potential neuroprotective properties. It mimics the activity of glutathione peroxidase, an important antioxidant enzyme, by scavenging reactive oxygen species (ROS) and reducing oxidative stress. Ebselen has been studied for various therapeutic applications, including as a treatment for neurological disorders, such as stroke and Alzheimer’s disease, and as a potential antiviral agent. It is also being explored for its ability to modulate immune responses and protect against tissue damage in inflammatory conditions.
CAS Number | 60940-34-3 |
Synonyms | 2-phenyl-1,2-benzisoselenazol-3(2H)-one |
Molecular Formula | C₁₃H₉NOSe |
Purity | ≥95% |
Target | Membrane Transporter/Ion Channel |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IUPAC Name | 2-phenyl-1,2-benzoselenazol-3-one |
InChI | InChI=1S/C13H9NOSe/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h1-9H |
InChIKey | DYEFUKCXAQOFHX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3[Se]2 |