For research use only. Not for therapeutic Use.
EC144（Cat No.:R015937）is a small molecule that functions as an inhibitor of the enzyme dihydrofolate reductase (DHFR), which plays a key role in DNA synthesis and cell division by reducing folate derivatives. By targeting DHFR, EC144 can disrupt cellular proliferation, making it a potential candidate for cancer therapy. It has shown promise in preclinical studies, particularly in targeting rapidly dividing cancer cells. Additionally, EC144 may be explored for its potential in treating other proliferative diseases.
| CAS Number | 911397-80-3 |
| Synonyms | 5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-methylpent-4-yn-2-ol |
| Molecular Formula | C21H24ClN5O2 |
| Purity | ≥95% |
| IUPAC Name | 5-[2-amino-4-chloro-7-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]pyrrolo[2,3-d]pyrimidin-5-yl]-2-methylpent-4-yn-2-ol |
| InChI | InChI=1S/C21H24ClN5O2/c1-12-9-24-15(13(2)17(12)29-5)11-27-10-14(7-6-8-21(3,4)28)16-18(22)25-20(23)26-19(16)27/h9-10,28H,8,11H2,1-5H3,(H2,23,25,26) |
| InChIKey | VOASEWXFCTZRDF-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C(=C1OC)C)CN2C=C(C3=C2N=C(N=C3Cl)N)C#CCC(C)(C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
