For research use only. Not for therapeutic Use.
EcDsbB-IN-12 (Cat.No:I012664) is a chemical compound with potential therapeutic applications. It acts as an inhibitor of the enzyme EcDsbB, which plays a critical role in the bacterial disulfide bond formation pathway. By targeting EcDsbB, EcDsbB-IN-12 disrupts bacterial protein folding and function, offering potential as an antimicrobial agent.
CAS Number | 112749-52-7 |
Synonyms | 4,5-Dichloro-2-(2-chlorobenzyl)pyridazin-3(2H)-one |
Molecular Formula | C11H7Cl3N2O |
Purity | ≥95% |
IUPAC Name | 4,5-dichloro-2-[(2-chlorophenyl)methyl]pyridazin-3-one |
InChI | InChI=1S/C11H7Cl3N2O/c12-8-4-2-1-3-7(8)6-16-11(17)10(14)9(13)5-15-16/h1-5H,6H2 |
InChIKey | OCSOJUHXYHYEKJ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CN2C(=O)C(=C(C=N2)Cl)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |