For research use only. Not for therapeutic Use.
EcDsbB-IN-9(CAT: I012663) represents a groundbreaking advancement as a specific inhibitor targeting EcDsbB, a crucial disulfide bond-forming enzyme within Gram-negative bacteria. By selectively disrupting the activity of EcDsbB, this novel compound holds the potential to impede essential disulfide bond formation processes vital for bacterial survival and virulence.
CAS Number | 41933-33-9 |
Synonyms | 4,5-Dichloro-2-benzylpyridazin-3(2H)-one |
Molecular Formula | C11H8Cl2N2O |
Purity | ≥95% |
IUPAC Name | 2-benzyl-4,5-dichloropyridazin-3-one |
InChI | InChI=1S/C11H8Cl2N2O/c12-9-6-14-15(11(16)10(9)13)7-8-4-2-1-3-5-8/h1-6H,7H2 |
InChIKey | AJHBQZQCDCTOFD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C(=O)C(=C(C=N2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |