For research use only. Not for therapeutic Use.
Eclitasertib (Cat.No:I026698) is an investigational anticancer compound. It functions as a selective inhibitor of the enzyme DNA-dependent protein kinase (DNA-PK), which is involved in DNA repair processes. Eclitasertib shows potential in the treatment of various cancers and is currently undergoing preclinical and clinical studies to evaluate its efficacy and safety.
| Catalog Number | I026698 |
| CAS Number | 2125450-76-0 |
| Synonyms | Eclitasertib; Eclitasertibum; |
| Molecular Formula | C19H18N6O3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4℃ for short term (days to weeks) or -20℃ for long term (months to years). |
| IUPAC Name | 5-benzyl-N-[(3S)-5-methyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| InChI | InChI=1S/C19H18N6O3/c1-25-17-14(8-5-9-20-17)28-11-13(19(25)27)21-18(26)16-22-15(23-24-16)10-12-6-3-2-4-7-12/h2-9,13H,10-11H2,1H3,(H,21,26)(H,22,23,24)/t13-/m0/s1 |
| InChIKey | XUZICJHIIJCKQQ-ZDUSSCGKSA-N |
| SMILES | CN(C([C@](NC(C1=NC(CC2=CC=CC=C2)=NN1)=O)([H])CO3)=O)C4=C3C=CC=N4 |
