For research use only. Not for therapeutic Use.
EDDHSA (Ethylenediamine-N,N’-disuccinic acid)(CAT: R013988) is a chelating agent primarily used for agricultural and environmental applications. It is a biodegradable alternative to traditional chelating agents like EDTA, making it an environmentally friendly option for binding and removing metal ions from soil or water. EDDHSA is often applied in fertilizers to increase the bioavailability of essential micronutrients, such as iron, to plants, especially in alkaline soils. Its strong chelation properties make it highly effective in preventing nutrient deficiencies, thus promoting healthier plant growth and higher crop yields.
Catalog Number | R013988 |
CAS Number | 57368-07-7 |
Synonyms | α,α’-(1,2-Ethanediyldiimino)bis[2-hydroxy-5-sulfo-benzeneacetic Acid; N,N-Ethylenebis[2-(2-hydroxy-5-sulfophenyl)glycine; N,N’-Ethylenebis[2-(2-hydroxy-5-sulfophenyl)glycine |
Molecular Formula | C18H20N2O12S2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[2-[[carboxy-(2-hydroxy-5-sulfophenyl)methyl]amino]ethylamino]-2-(2-hydroxy-5-sulfophenyl)acetic acid |
InChI | InChI=1S/C18H20N2O12S2/c21-13-3-1-9(33(27,28)29)7-11(13)15(17(23)24)19-5-6-20-16(18(25)26)12-8-10(34(30,31)32)2-4-14(12)22/h1-4,7-8,15-16,19-22H,5-6H2,(H,23,24)(H,25,26)(H,27,28,29)(H,30,31,32) |
InChIKey | GOPWHIPESJZSFI-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)O)C(C(=O)O)NCCNC(C2=C(C=CC(=C2)S(=O)(=O)O)O)C(=O)O)O |